C15H14F2O2 — CID 174501596
1-(3,4-difluorophenyl)-3,4-dimethoxy-2-methylbenzene (PubChem CID 174501596) has the molecular formula C15H14F2O2 and a molecular weight of 264.27 g/mol. Its IUPAC name is 1-(3,4-difluorophenyl)-3,4-dimethoxy-2-methylbenzene.
| Compound Name | 1-(3,4-difluorophenyl)-3,4-dimethoxy-2-methylbenzene |
|---|---|
| PubChem CID | 174501596 |
| Molecular Formula | C15H14F2O2 |
| Molecular Weight | 264.27 g/mol |
| Exact Mass | 264.10 |
| IUPAC Name | 1-(3,4-difluorophenyl)-3,4-dimethoxy-2-methylbenzene |
| SMILES | COc1ccc(-c2ccc(F)c(F)c2)c(C)c1OC |
| InChI | InChI=1S/C15H14F2O2/c1-9-11(5-7-14(18-2)15(9)19-3)10-4-6-12(16)13(17)8-10/h4-8H,1-3H3 |
| InChIKey | BBFRAQUXCHPHRW-UHFFFAOYSA-N |
| XLogP | 3.96 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.27 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |