C18H16F2O4 — CID 110447040
(E)-3-[3-(3,4-difluorophenyl)-4,5-dimethoxyphenyl]but-2-enoic acid (PubChem CID 110447040) has the molecular formula C18H16F2O4 and a molecular weight of 334.32 g/mol. Its IUPAC name is (E)-3-[3-(3,4-difluorophenyl)-4,5-dimethoxyphenyl]but-2-enoic acid.
| Compound Name | (E)-3-[3-(3,4-difluorophenyl)-4,5-dimethoxyphenyl]but-2-enoic acid |
|---|---|
| PubChem CID | 110447040 |
| Molecular Formula | C18H16F2O4 |
| Molecular Weight | 334.32 g/mol |
| Exact Mass | 334.10 |
| IUPAC Name | (E)-3-[3-(3,4-difluorophenyl)-4,5-dimethoxyphenyl]but-2-enoic acid |
| SMILES | COc1cc(/C(C)=C/C(=O)O)cc(-c2ccc(F)c(F)c2)c1OC |
| InChI | InChI=1S/C18H16F2O4/c1-10(6-17(21)22)12-7-13(18(24-3)16(9-12)23-2)11-4-5-14(19)15(20)8-11/h4-9H,1-3H3,(H,21,22)/b10-6+ |
| InChIKey | DUXAMQIHICNUDG-UXBLZVDNSA-N |
| XLogP | 4.14 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.32 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|