C18H16F2O4 — CID 141327398
2-(3,4-difluorophenyl)-1-(3,4,5-trimethoxyphenyl)prop-2-en-1-one (PubChem CID 141327398) has the molecular formula C18H16F2O4 and a molecular weight of 334.32 g/mol. Its IUPAC name is 2-(3,4-difluorophenyl)-1-(3,4,5-trimethoxyphenyl)prop-2-en-1-one.
| Compound Name | 2-(3,4-difluorophenyl)-1-(3,4,5-trimethoxyphenyl)prop-2-en-1-one |
|---|---|
| PubChem CID | 141327398 |
| Molecular Formula | C18H16F2O4 |
| Molecular Weight | 334.32 g/mol |
| Exact Mass | 334.10 |
| IUPAC Name | 2-(3,4-difluorophenyl)-1-(3,4,5-trimethoxyphenyl)prop-2-en-1-one |
| SMILES | C=C(C(=O)c1cc(OC)c(OC)c(OC)c1)c1ccc(F)c(F)c1 |
| InChI | InChI=1S/C18H16F2O4/c1-10(11-5-6-13(19)14(20)7-11)17(21)12-8-15(22-2)18(24-4)16(9-12)23-3/h5-9H,1H2,2-4H3 |
| InChIKey | BSQINZJWCVKSBQ-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.32 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|