C17H17F2NO5 — CID 26216294
2-(3,4-difluorophenoxy)-N-(3,4,5-trimethoxyphenyl)acetamide (PubChem CID 26216294) has the molecular formula C17H17F2NO5 and a molecular weight of 353.32 g/mol. Its IUPAC name is 2-(3,4-difluorophenoxy)-N-(3,4,5-trimethoxyphenyl)acetamide.
| Compound Name | 2-(3,4-difluorophenoxy)-N-(3,4,5-trimethoxyphenyl)acetamide |
|---|---|
| PubChem CID | 26216294 |
| Molecular Formula | C17H17F2NO5 |
| Molecular Weight | 353.32 g/mol |
| Exact Mass | 353.11 |
| IUPAC Name | 2-(3,4-difluorophenoxy)-N-(3,4,5-trimethoxyphenyl)acetamide |
| SMILES | COc1cc(NC(=O)COc2ccc(F)c(F)c2)cc(OC)c1OC |
| InChI | InChI=1S/C17H17F2NO5/c1-22-14-6-10(7-15(23-2)17(14)24-3)20-16(21)9-25-11-4-5-12(18)13(19)8-11/h4-8H,9H2,1-3H3,(H,20,21) |
| InChIKey | WHMDLYAGUMOHHL-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 66.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.32 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |