methyl 4-[2-oxo-2-(3,4,5-trimethoxyanilino)ethoxy]benzoate

C19H21NO7 — CID 2495618

IUPACmethyl 4-[2-oxo-2-(3,4,5-trimethoxyanilino)ethoxy]benzoate
SMILESCOC(=O)c1ccc(OCC(=O)Nc2cc(OC)c(OC)c(OC)c2)cc1
InChIInChI=1S/C19H21NO7/c1-23-15-9-13(10-16(24-2)18(15)25-3)20-17(21)11-27-14-7-5-12(6-8-14)19(22)26-4/h5-10H,11H2,1-4H3,(H,20,21)
InChIKeyMQYWADUIECHHDT-UHFFFAOYSA-N
MW375.38 g/mol
LogP2.52
Rot. Bonds8

About methyl 4-[2-oxo-2-(3,4,5-trimethoxyanilino)ethoxy]benzoate

methyl 4-[2-oxo-2-(3,4,5-trimethoxyanilino)ethoxy]benzoate (PubChem CID 2495618) has the molecular formula C19H21NO7 and a molecular weight of 375.38 g/mol. Its IUPAC name is methyl 4-[2-oxo-2-(3,4,5-trimethoxyanilino)ethoxy]benzoate.

Molecular Properties

Compound Namemethyl 4-[2-oxo-2-(3,4,5-trimethoxyanilino)ethoxy]benzoate
PubChem CID2495618
Molecular FormulaC19H21NO7
Molecular Weight375.38 g/mol
Exact Mass375.13
IUPAC Namemethyl 4-[2-oxo-2-(3,4,5-trimethoxyanilino)ethoxy]benzoate
SMILESCOC(=O)c1ccc(OCC(=O)Nc2cc(OC)c(OC)c(OC)c2)cc1
InChIInChI=1S/C19H21NO7/c1-23-15-9-13(10-16(24-2)18(15)25-3)20-17(21)11-27-14-7-5-12(6-8-14)19(22)26-4/h5-10H,11H2,1-4H3,(H,20,21)
InChIKeyMQYWADUIECHHDT-UHFFFAOYSA-N
XLogP2.52
TPSA92.32 Ų
H-Bond Donors1
H-Bond Acceptors7
Rotatable Bonds8
Heavy Atoms27
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500375.38
LogP ≤ 52.52
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 107

Analyze methyl 4-[2-oxo-2-(3,4,5-trimethoxyanilino)ethoxy]benzoate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of methyl 4-[2-oxo-2-(3,4,5-trimethoxyanilino)ethoxy]benzoate?
The IUPAC name of methyl 4-[2-oxo-2-(3,4,5-trimethoxyanilino)ethoxy]benzoate (CID 2495618) is methyl 4-[2-oxo-2-(3,4,5-trimethoxyanilino)ethoxy]benzoate.
What is the SMILES notation for methyl 4-[2-oxo-2-(3,4,5-trimethoxyanilino)ethoxy]benzoate?
The canonical SMILES for methyl 4-[2-oxo-2-(3,4,5-trimethoxyanilino)ethoxy]benzoate is COC(=O)c1ccc(OCC(=O)Nc2cc(OC)c(OC)c(OC)c2)cc1.
What is the InChIKey of methyl 4-[2-oxo-2-(3,4,5-trimethoxyanilino)ethoxy]benzoate?
The InChIKey is MQYWADUIECHHDT-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H21NO7/c1-23-15-9-13(10-16(24-2)18(15)25-3)20-17(21)11-27-14-7-5-12(6-8-14)19(22)26-4/h5-10H,11H2,1-4H3,(H,20,21).
What are the key properties of methyl 4-[2-oxo-2-(3,4,5-trimethoxyanilino)ethoxy]benzoate?
methyl 4-[2-oxo-2-(3,4,5-trimethoxyanilino)ethoxy]benzoate has a molecular weight of 375.38 g/mol, XLogP of 2.52, 8 rotatable bonds, 1 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 4-[2-oxo-2-(3,4,5-trimethoxyanilino)ethoxy]benzoate is sourced from PubChem (CID 2495618), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).