C19H21NO7 — CID 2495618
methyl 4-[2-oxo-2-(3,4,5-trimethoxyanilino)ethoxy]benzoate (PubChem CID 2495618) has the molecular formula C19H21NO7 and a molecular weight of 375.38 g/mol. Its IUPAC name is methyl 4-[2-oxo-2-(3,4,5-trimethoxyanilino)ethoxy]benzoate.
| Compound Name | methyl 4-[2-oxo-2-(3,4,5-trimethoxyanilino)ethoxy]benzoate |
|---|---|
| PubChem CID | 2495618 |
| Molecular Formula | C19H21NO7 |
| Molecular Weight | 375.38 g/mol |
| Exact Mass | 375.13 |
| IUPAC Name | methyl 4-[2-oxo-2-(3,4,5-trimethoxyanilino)ethoxy]benzoate |
| SMILES | COC(=O)c1ccc(OCC(=O)Nc2cc(OC)c(OC)c(OC)c2)cc1 |
| InChI | InChI=1S/C19H21NO7/c1-23-15-9-13(10-16(24-2)18(15)25-3)20-17(21)11-27-14-7-5-12(6-8-14)19(22)26-4/h5-10H,11H2,1-4H3,(H,20,21) |
| InChIKey | MQYWADUIECHHDT-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 92.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.38 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |