C20H23NO6 — CID 49017115
4-(4-methoxyphenyl)-4-oxo-N-(3,4,5-trimethoxyphenyl)butanamide (PubChem CID 49017115) has the molecular formula C20H23NO6 and a molecular weight of 373.41 g/mol. Its IUPAC name is 4-(4-methoxyphenyl)-4-oxo-N-(3,4,5-trimethoxyphenyl)butanamide.
| Compound Name | 4-(4-methoxyphenyl)-4-oxo-N-(3,4,5-trimethoxyphenyl)butanamide |
|---|---|
| PubChem CID | 49017115 |
| Molecular Formula | C20H23NO6 |
| Molecular Weight | 373.41 g/mol |
| Exact Mass | 373.15 |
| IUPAC Name | 4-(4-methoxyphenyl)-4-oxo-N-(3,4,5-trimethoxyphenyl)butanamide |
| SMILES | COc1ccc(C(=O)CCC(=O)Nc2cc(OC)c(OC)c(OC)c2)cc1 |
| InChI | InChI=1S/C20H23NO6/c1-24-15-7-5-13(6-8-15)16(22)9-10-19(23)21-14-11-17(25-2)20(27-4)18(12-14)26-3/h5-8,11-12H,9-10H2,1-4H3,(H,21,23) |
| InChIKey | LJFCMILVIREZSL-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 83.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.41 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |