C19H20N2O7 — CID 8678401
[2-(3,4-dimethoxyanilino)-2-oxoethyl] 4-(2-amino-2-oxoethoxy)benzoate (PubChem CID 8678401) has the molecular formula C19H20N2O7 and a molecular weight of 388.38 g/mol. Its IUPAC name is [2-(3,4-dimethoxyanilino)-2-oxoethyl] 4-(2-amino-2-oxoethoxy)benzoate.
| Compound Name | [2-(3,4-dimethoxyanilino)-2-oxoethyl] 4-(2-amino-2-oxoethoxy)benzoate |
|---|---|
| PubChem CID | 8678401 |
| Molecular Formula | C19H20N2O7 |
| Molecular Weight | 388.38 g/mol |
| Exact Mass | 388.13 |
| IUPAC Name | [2-(3,4-dimethoxyanilino)-2-oxoethyl] 4-(2-amino-2-oxoethoxy)benzoate |
| SMILES | COc1ccc(NC(=O)COC(=O)c2ccc(OCC(N)=O)cc2)cc1OC |
| InChI | InChI=1S/C19H20N2O7/c1-25-15-8-5-13(9-16(15)26-2)21-18(23)11-28-19(24)12-3-6-14(7-4-12)27-10-17(20)22/h3-9H,10-11H2,1-2H3,(H2,20,22)(H,21,23) |
| InChIKey | BPSLVMIPTZMLHP-UHFFFAOYSA-N |
| XLogP | 1.36 |
| TPSA | 126.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.38 |
| LogP ≤ 5 | 1.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |