methyl 4-[2-(3,4-diethoxyanilino)-2-oxoethoxy]benzoate

C20H23NO6 — CID 7667527

IUPACmethyl 4-[2-(3,4-diethoxyanilino)-2-oxoethoxy]benzoate
SMILESCCOc1ccc(NC(=O)COc2ccc(C(=O)OC)cc2)cc1OCC
InChIInChI=1S/C20H23NO6/c1-4-25-17-11-8-15(12-18(17)26-5-2)21-19(22)13-27-16-9-6-14(7-10-16)20(23)24-3/h6-12H,4-5,13H2,1-3H3,(H,21,22)
InChIKeyNNVOLXHHSRFZAQ-UHFFFAOYSA-N
MW373.41 g/mol
LogP3.29
Rot. Bonds9

About methyl 4-[2-(3,4-diethoxyanilino)-2-oxoethoxy]benzoate

methyl 4-[2-(3,4-diethoxyanilino)-2-oxoethoxy]benzoate (PubChem CID 7667527) has the molecular formula C20H23NO6 and a molecular weight of 373.41 g/mol. Its IUPAC name is methyl 4-[2-(3,4-diethoxyanilino)-2-oxoethoxy]benzoate.

Molecular Properties

Compound Namemethyl 4-[2-(3,4-diethoxyanilino)-2-oxoethoxy]benzoate
PubChem CID7667527
Molecular FormulaC20H23NO6
Molecular Weight373.41 g/mol
Exact Mass373.15
IUPAC Namemethyl 4-[2-(3,4-diethoxyanilino)-2-oxoethoxy]benzoate
SMILESCCOc1ccc(NC(=O)COc2ccc(C(=O)OC)cc2)cc1OCC
InChIInChI=1S/C20H23NO6/c1-4-25-17-11-8-15(12-18(17)26-5-2)21-19(22)13-27-16-9-6-14(7-10-16)20(23)24-3/h6-12H,4-5,13H2,1-3H3,(H,21,22)
InChIKeyNNVOLXHHSRFZAQ-UHFFFAOYSA-N
XLogP3.29
TPSA83.09 Ų
H-Bond Donors1
H-Bond Acceptors6
Rotatable Bonds9
Heavy Atoms27
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500373.41
LogP ≤ 53.29
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 106

Analyze methyl 4-[2-(3,4-diethoxyanilino)-2-oxoethoxy]benzoate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of methyl 4-[2-(3,4-diethoxyanilino)-2-oxoethoxy]benzoate?
The IUPAC name of methyl 4-[2-(3,4-diethoxyanilino)-2-oxoethoxy]benzoate (CID 7667527) is methyl 4-[2-(3,4-diethoxyanilino)-2-oxoethoxy]benzoate.
What is the SMILES notation for methyl 4-[2-(3,4-diethoxyanilino)-2-oxoethoxy]benzoate?
The canonical SMILES for methyl 4-[2-(3,4-diethoxyanilino)-2-oxoethoxy]benzoate is CCOc1ccc(NC(=O)COc2ccc(C(=O)OC)cc2)cc1OCC.
What is the InChIKey of methyl 4-[2-(3,4-diethoxyanilino)-2-oxoethoxy]benzoate?
The InChIKey is NNVOLXHHSRFZAQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H23NO6/c1-4-25-17-11-8-15(12-18(17)26-5-2)21-19(22)13-27-16-9-6-14(7-10-16)20(23)24-3/h6-12H,4-5,13H2,1-3H3,(H,21,22).
What are the key properties of methyl 4-[2-(3,4-diethoxyanilino)-2-oxoethoxy]benzoate?
methyl 4-[2-(3,4-diethoxyanilino)-2-oxoethoxy]benzoate has a molecular weight of 373.41 g/mol, XLogP of 3.29, 9 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 4-[2-(3,4-diethoxyanilino)-2-oxoethoxy]benzoate is sourced from PubChem (CID 7667527), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).