C21H25NO7 — CID 7487592
[2-(3,4-diethoxyanilino)-2-oxoethyl] 2,5-dimethoxybenzoate (PubChem CID 7487592) has the molecular formula C21H25NO7 and a molecular weight of 403.43 g/mol. Its IUPAC name is [2-(3,4-diethoxyanilino)-2-oxoethyl] 2,5-dimethoxybenzoate.
| Compound Name | [2-(3,4-diethoxyanilino)-2-oxoethyl] 2,5-dimethoxybenzoate |
|---|---|
| PubChem CID | 7487592 |
| Molecular Formula | C21H25NO7 |
| Molecular Weight | 403.43 g/mol |
| Exact Mass | 403.16 |
| IUPAC Name | [2-(3,4-diethoxyanilino)-2-oxoethyl] 2,5-dimethoxybenzoate |
| SMILES | CCOc1ccc(NC(=O)COC(=O)c2cc(OC)ccc2OC)cc1OCC |
| InChI | InChI=1S/C21H25NO7/c1-5-27-18-9-7-14(11-19(18)28-6-2)22-20(23)13-29-21(24)16-12-15(25-3)8-10-17(16)26-4/h7-12H,5-6,13H2,1-4H3,(H,22,23) |
| InChIKey | VKZIQSKBEWMSEL-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 92.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.43 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |