C19H20ClNO7 — CID 35943053
[2-oxo-2-(3,4,5-trimethoxyanilino)ethyl] 2-(4-chlorophenoxy)acetate (PubChem CID 35943053) has the molecular formula C19H20ClNO7 and a molecular weight of 409.82 g/mol. Its IUPAC name is [2-oxo-2-(3,4,5-trimethoxyanilino)ethyl] 2-(4-chlorophenoxy)acetate.
| Compound Name | [2-oxo-2-(3,4,5-trimethoxyanilino)ethyl] 2-(4-chlorophenoxy)acetate |
|---|---|
| PubChem CID | 35943053 |
| Molecular Formula | C19H20ClNO7 |
| Molecular Weight | 409.82 g/mol |
| Exact Mass | 409.09 |
| IUPAC Name | [2-oxo-2-(3,4,5-trimethoxyanilino)ethyl] 2-(4-chlorophenoxy)acetate |
| SMILES | COc1cc(NC(=O)COC(=O)COc2ccc(Cl)cc2)cc(OC)c1OC |
| InChI | InChI=1S/C19H20ClNO7/c1-24-15-8-13(9-16(25-2)19(15)26-3)21-17(22)10-28-18(23)11-27-14-6-4-12(20)5-7-14/h4-9H,10-11H2,1-3H3,(H,21,22) |
| InChIKey | ZSVBRZAFCUMBMZ-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 92.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.82 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |