C13H17NO6 — CID 1252029
[2-oxo-2-(3,4,5-trimethoxyanilino)ethyl] acetate (PubChem CID 1252029) has the molecular formula C13H17NO6 and a molecular weight of 283.28 g/mol. Its IUPAC name is [2-oxo-2-(3,4,5-trimethoxyanilino)ethyl] acetate.
| Compound Name | [2-oxo-2-(3,4,5-trimethoxyanilino)ethyl] acetate |
|---|---|
| PubChem CID | 1252029 |
| Molecular Formula | C13H17NO6 |
| Molecular Weight | 283.28 g/mol |
| Exact Mass | 283.11 |
| IUPAC Name | [2-oxo-2-(3,4,5-trimethoxyanilino)ethyl] acetate |
| SMILES | COc1cc(NC(=O)COC(C)=O)cc(OC)c1OC |
| InChI | InChI=1S/C13H17NO6/c1-8(15)20-7-12(16)14-9-5-10(17-2)13(19-4)11(6-9)18-3/h5-6H,7H2,1-4H3,(H,14,16) |
| InChIKey | HSJJTBLOXAZUBZ-UHFFFAOYSA-N |
| XLogP | 1.21 |
| TPSA | 83.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.28 |
| LogP ≤ 5 | 1.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |