C16H27ClN2O4 — CID 119671440
7-amino-N-(3,4,5-trimethoxyphenyl)heptanamide;hydrochloride (PubChem CID 119671440) has the molecular formula C16H27ClN2O4 and a molecular weight of 346.86 g/mol. Its IUPAC name is 7-amino-N-(3,4,5-trimethoxyphenyl)heptanamide;hydrochloride.
| Compound Name | 7-amino-N-(3,4,5-trimethoxyphenyl)heptanamide;hydrochloride |
|---|---|
| PubChem CID | 119671440 |
| Molecular Formula | C16H27ClN2O4 |
| Molecular Weight | 346.86 g/mol |
| Exact Mass | 346.17 |
| IUPAC Name | 7-amino-N-(3,4,5-trimethoxyphenyl)heptanamide;hydrochloride |
| SMILES | COc1cc(NC(=O)CCCCCCN)cc(OC)c1OC.Cl |
| InChI | InChI=1S/C16H26N2O4.ClH/c1-20-13-10-12(11-14(21-2)16(13)22-3)18-15(19)8-6-4-5-7-9-17;/h10-11H,4-9,17H2,1-3H3,(H,18,19);1H |
| InChIKey | GNHQAVACZSOHSM-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 82.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.86 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|