C15H24Cl2N2O3 — CID 119683375
7-amino-N-(4-chloro-2,5-dimethoxyphenyl)heptanamide;hydrochloride (PubChem CID 119683375) has the molecular formula C15H24Cl2N2O3 and a molecular weight of 351.27 g/mol. Its IUPAC name is 7-amino-N-(4-chloro-2,5-dimethoxyphenyl)heptanamide;hydrochloride.
| Compound Name | 7-amino-N-(4-chloro-2,5-dimethoxyphenyl)heptanamide;hydrochloride |
|---|---|
| PubChem CID | 119683375 |
| Molecular Formula | C15H24Cl2N2O3 |
| Molecular Weight | 351.27 g/mol |
| Exact Mass | 350.12 |
| IUPAC Name | 7-amino-N-(4-chloro-2,5-dimethoxyphenyl)heptanamide;hydrochloride |
| SMILES | COc1cc(NC(=O)CCCCCCN)c(OC)cc1Cl.Cl |
| InChI | InChI=1S/C15H23ClN2O3.ClH/c1-20-13-10-12(14(21-2)9-11(13)16)18-15(19)7-5-3-4-6-8-17;/h9-10H,3-8,17H2,1-2H3,(H,18,19);1H |
| InChIKey | IYFYZRYMVABINJ-UHFFFAOYSA-N |
| XLogP | 3.63 |
| TPSA | 73.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.27 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|