C10H13ClN2O3 — CID 24690060
2-amino-N-(5-chloro-2,4-dimethoxyphenyl)acetamide (PubChem CID 24690060) has the molecular formula C10H13ClN2O3 and a molecular weight of 244.68 g/mol. Its IUPAC name is 2-amino-N-(5-chloro-2,4-dimethoxyphenyl)acetamide.
| Compound Name | 2-amino-N-(5-chloro-2,4-dimethoxyphenyl)acetamide |
|---|---|
| PubChem CID | 24690060 |
| Molecular Formula | C10H13ClN2O3 |
| Molecular Weight | 244.68 g/mol |
| Exact Mass | 244.06 |
| IUPAC Name | 2-amino-N-(5-chloro-2,4-dimethoxyphenyl)acetamide |
| SMILES | COc1cc(OC)c(NC(=O)CN)cc1Cl |
| InChI | InChI=1S/C10H13ClN2O3/c1-15-8-4-9(16-2)7(3-6(8)11)13-10(14)5-12/h3-4H,5,12H2,1-2H3,(H,13,14) |
| InChIKey | WQIKJWXBAUJAPU-UHFFFAOYSA-N |
| XLogP | 1.25 |
| TPSA | 73.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.68 |
| LogP ≤ 5 | 1.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |