C13H18ClNO4 — CID 47410572
N-(5-chloro-2,4-dimethoxyphenyl)-2-propan-2-yloxyacetamide (PubChem CID 47410572) has the molecular formula C13H18ClNO4 and a molecular weight of 287.74 g/mol. Its IUPAC name is N-(5-chloro-2,4-dimethoxyphenyl)-2-propan-2-yloxyacetamide.
| Compound Name | N-(5-chloro-2,4-dimethoxyphenyl)-2-propan-2-yloxyacetamide |
|---|---|
| PubChem CID | 47410572 |
| Molecular Formula | C13H18ClNO4 |
| Molecular Weight | 287.74 g/mol |
| Exact Mass | 287.09 |
| IUPAC Name | N-(5-chloro-2,4-dimethoxyphenyl)-2-propan-2-yloxyacetamide |
| SMILES | COc1cc(OC)c(NC(=O)COC(C)C)cc1Cl |
| InChI | InChI=1S/C13H18ClNO4/c1-8(2)19-7-13(16)15-10-5-9(14)11(17-3)6-12(10)18-4/h5-6,8H,7H2,1-4H3,(H,15,16) |
| InChIKey | POMHRJBLBBPHHY-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 56.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.74 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |