C12H17ClN2O3 — CID 62639099
N-(5-chloro-2,4-dimethoxyphenyl)-2-(methylamino)propanamide (PubChem CID 62639099) has the molecular formula C12H17ClN2O3 and a molecular weight of 272.73 g/mol. Its IUPAC name is N-(5-chloro-2,4-dimethoxyphenyl)-2-(methylamino)propanamide.
| Compound Name | N-(5-chloro-2,4-dimethoxyphenyl)-2-(methylamino)propanamide |
|---|---|
| PubChem CID | 62639099 |
| Molecular Formula | C12H17ClN2O3 |
| Molecular Weight | 272.73 g/mol |
| Exact Mass | 272.09 |
| IUPAC Name | N-(5-chloro-2,4-dimethoxyphenyl)-2-(methylamino)propanamide |
| SMILES | CNC(C)C(=O)Nc1cc(Cl)c(OC)cc1OC |
| InChI | InChI=1S/C12H17ClN2O3/c1-7(14-2)12(16)15-9-5-8(13)10(17-3)6-11(9)18-4/h5-7,14H,1-4H3,(H,15,16) |
| InChIKey | SSLDBNNFTDBFPL-UHFFFAOYSA-N |
| XLogP | 1.90 |
| TPSA | 59.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.73 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |