C10H12ClNO4 — CID 17173078
methyl N-(5-chloro-2,4-dimethoxyphenyl)carbamate (PubChem CID 17173078) has the molecular formula C10H12ClNO4 and a molecular weight of 245.66 g/mol. Its IUPAC name is methyl N-(5-chloro-2,4-dimethoxyphenyl)carbamate.
| Compound Name | methyl N-(5-chloro-2,4-dimethoxyphenyl)carbamate |
|---|---|
| PubChem CID | 17173078 |
| Molecular Formula | C10H12ClNO4 |
| Molecular Weight | 245.66 g/mol |
| Exact Mass | 245.05 |
| IUPAC Name | methyl N-(5-chloro-2,4-dimethoxyphenyl)carbamate |
| SMILES | COC(=O)Nc1cc(Cl)c(OC)cc1OC |
| InChI | InChI=1S/C10H12ClNO4/c1-14-8-5-9(15-2)7(4-6(8)11)12-10(13)16-3/h4-5H,1-3H3,(H,12,13) |
| InChIKey | ZDMBFIBGJQILPI-UHFFFAOYSA-N |
| XLogP | 2.54 |
| TPSA | 56.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.66 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |