C12H11ClNO5- — CID 6928919
(E)-4-(5-chloro-2,4-dimethoxyanilino)-4-oxobut-2-enoate (PubChem CID 6928919) has the molecular formula C12H11ClNO5- and a molecular weight of 284.68 g/mol. Its IUPAC name is (E)-4-(5-chloro-2,4-dimethoxyanilino)-4-oxobut-2-enoate.
| Compound Name | (E)-4-(5-chloro-2,4-dimethoxyanilino)-4-oxobut-2-enoate |
|---|---|
| PubChem CID | 6928919 |
| Molecular Formula | C12H11ClNO5- |
| Molecular Weight | 284.68 g/mol |
| Exact Mass | 284.03 |
| IUPAC Name | (E)-4-(5-chloro-2,4-dimethoxyanilino)-4-oxobut-2-enoate |
| SMILES | COc1cc(OC)c(NC(=O)/C=C/C(=O)[O-])cc1Cl |
| InChI | InChI=1S/C12H12ClNO5/c1-18-9-6-10(19-2)8(5-7(9)13)14-11(15)3-4-12(16)17/h3-6H,1-2H3,(H,14,15)(H,16,17)/p-1/b4-3+ |
| InChIKey | OMMWQXYUXSUUCA-ONEGZZNKSA-M |
| XLogP | 0.60 |
| TPSA | 87.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.68 |
| LogP ≤ 5 | 0.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|