C11H12ClNO3 — CID 43616303
N-(4-chloro-2,5-dimethoxyphenyl)prop-2-enamide (PubChem CID 43616303) has the molecular formula C11H12ClNO3 and a molecular weight of 241.67 g/mol. Its IUPAC name is N-(4-chloro-2,5-dimethoxyphenyl)prop-2-enamide.
| Compound Name | N-(4-chloro-2,5-dimethoxyphenyl)prop-2-enamide |
|---|---|
| PubChem CID | 43616303 |
| Molecular Formula | C11H12ClNO3 |
| Molecular Weight | 241.67 g/mol |
| Exact Mass | 241.05 |
| IUPAC Name | N-(4-chloro-2,5-dimethoxyphenyl)prop-2-enamide |
| SMILES | C=CC(=O)Nc1cc(OC)c(Cl)cc1OC |
| InChI | InChI=1S/C11H12ClNO3/c1-4-11(14)13-8-6-9(15-2)7(12)5-10(8)16-3/h4-6H,1H2,2-3H3,(H,13,14) |
| InChIKey | GTYYMWHDASHQOO-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.67 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|