C11H13NO3 — CID 881958
N-(2,5-dimethoxyphenyl)prop-2-enamide (PubChem CID 881958) has the molecular formula C11H13NO3 and a molecular weight of 207.23 g/mol. Its IUPAC name is N-(2,5-dimethoxyphenyl)prop-2-enamide.
| Compound Name | N-(2,5-dimethoxyphenyl)prop-2-enamide |
|---|---|
| PubChem CID | 881958 |
| Molecular Formula | C11H13NO3 |
| Molecular Weight | 207.23 g/mol |
| Exact Mass | 207.09 |
| IUPAC Name | N-(2,5-dimethoxyphenyl)prop-2-enamide |
| SMILES | C=CC(=O)Nc1cc(OC)ccc1OC |
| InChI | InChI=1S/C11H13NO3/c1-4-11(13)12-9-7-8(14-2)5-6-10(9)15-3/h4-7H,1H2,2-3H3,(H,12,13) |
| InChIKey | BMHRZYRYDQEWTC-UHFFFAOYSA-N |
| XLogP | 1.83 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 207.23 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|