C12H16N2O2 — CID 144945508
N-[2-(ethylamino)-4-methoxyphenyl]prop-2-enamide (PubChem CID 144945508) has the molecular formula C12H16N2O2 and a molecular weight of 220.27 g/mol. Its IUPAC name is N-[2-(ethylamino)-4-methoxyphenyl]prop-2-enamide.
| Compound Name | N-[2-(ethylamino)-4-methoxyphenyl]prop-2-enamide |
|---|---|
| PubChem CID | 144945508 |
| Molecular Formula | C12H16N2O2 |
| Molecular Weight | 220.27 g/mol |
| Exact Mass | 220.12 |
| IUPAC Name | N-[2-(ethylamino)-4-methoxyphenyl]prop-2-enamide |
| SMILES | C=CC(=O)Nc1ccc(OC)cc1NCC |
| InChI | InChI=1S/C12H16N2O2/c1-4-12(15)14-10-7-6-9(16-3)8-11(10)13-5-2/h4,6-8,13H,1,5H2,2-3H3,(H,14,15) |
| InChIKey | HCYPNYJHEMMWDB-UHFFFAOYSA-N |
| XLogP | 2.25 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.27 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|