C12H15NO2 — CID 43696159
N-(3-methoxy-2,4-dimethylphenyl)prop-2-enamide (PubChem CID 43696159) has the molecular formula C12H15NO2 and a molecular weight of 205.26 g/mol. Its IUPAC name is N-(3-methoxy-2,4-dimethylphenyl)prop-2-enamide.
| Compound Name | N-(3-methoxy-2,4-dimethylphenyl)prop-2-enamide |
|---|---|
| PubChem CID | 43696159 |
| Molecular Formula | C12H15NO2 |
| Molecular Weight | 205.26 g/mol |
| Exact Mass | 205.11 |
| IUPAC Name | N-(3-methoxy-2,4-dimethylphenyl)prop-2-enamide |
| SMILES | C=CC(=O)Nc1ccc(C)c(OC)c1C |
| InChI | InChI=1S/C12H15NO2/c1-5-11(14)13-10-7-6-8(2)12(15-4)9(10)3/h5-7H,1H2,2-4H3,(H,13,14) |
| InChIKey | HKANSGHGWWIMBA-UHFFFAOYSA-N |
| XLogP | 2.44 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 205.26 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|