C10H13NO2 — CID 64992554
N-(3-methoxy-2,4-dimethylphenyl)formamide (PubChem CID 64992554) has the molecular formula C10H13NO2 and a molecular weight of 179.22 g/mol. Its IUPAC name is N-(3-methoxy-2,4-dimethylphenyl)formamide.
| Compound Name | N-(3-methoxy-2,4-dimethylphenyl)formamide |
|---|---|
| PubChem CID | 64992554 |
| Molecular Formula | C10H13NO2 |
| Molecular Weight | 179.22 g/mol |
| Exact Mass | 179.09 |
| IUPAC Name | N-(3-methoxy-2,4-dimethylphenyl)formamide |
| SMILES | COc1c(C)ccc(NC=O)c1C |
| InChI | InChI=1S/C10H13NO2/c1-7-4-5-9(11-6-12)8(2)10(7)13-3/h4-6H,1-3H3,(H,11,12) |
| InChIKey | PPOSMAJSRWUPQI-UHFFFAOYSA-N |
| XLogP | 1.88 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 179.22 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|