C10H15NO — CID 143644303
N-(2,3-dimethylphenyl)formamide;methane (PubChem CID 143644303) has the molecular formula C10H15NO and a molecular weight of 165.24 g/mol. Its IUPAC name is N-(2,3-dimethylphenyl)formamide;methane.
| Compound Name | N-(2,3-dimethylphenyl)formamide;methane |
|---|---|
| PubChem CID | 143644303 |
| Molecular Formula | C10H15NO |
| Molecular Weight | 165.24 g/mol |
| Exact Mass | 165.12 |
| IUPAC Name | N-(2,3-dimethylphenyl)formamide;methane |
| SMILES | C.Cc1cccc(NC=O)c1C |
| InChI | InChI=1S/C9H11NO.CH4/c1-7-4-3-5-9(8(7)2)10-6-11;/h3-6H,1-2H3,(H,10,11);1H4 |
| InChIKey | CLQALEJHJKCSGP-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 165.24 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|