C14H25NO — CID 154675662
ethane;propanal;N,2,3-trimethylaniline (PubChem CID 154675662) has the molecular formula C14H25NO and a molecular weight of 223.36 g/mol. Its IUPAC name is ethane;propanal;N,2,3-trimethylaniline.
| Compound Name | ethane;propanal;N,2,3-trimethylaniline |
|---|---|
| PubChem CID | 154675662 |
| Molecular Formula | C14H25NO |
| Molecular Weight | 223.36 g/mol |
| Exact Mass | 223.19 |
| IUPAC Name | ethane;propanal;N,2,3-trimethylaniline |
| SMILES | CC.CCC=O.CNc1cccc(C)c1C |
| InChI | InChI=1S/C9H13N.C3H6O.C2H6/c1-7-5-4-6-9(10-3)8(7)2;1-2-3-4;1-2/h4-6,10H,1-3H3;3H,2H2,1H3;1-2H3 |
| InChIKey | MVXVMHWGHGQJDB-UHFFFAOYSA-N |
| XLogP | 3.97 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.36 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|