C11H18 — CID 54068667
ethane;1,2,3-trimethylbenzene (PubChem CID 54068667) has the molecular formula C11H18 and a molecular weight of 150.26 g/mol. Its IUPAC name is ethane;1,2,3-trimethylbenzene.
| Compound Name | ethane;1,2,3-trimethylbenzene |
|---|---|
| PubChem CID | 54068667 |
| Molecular Formula | C11H18 |
| Molecular Weight | 150.26 g/mol |
| Exact Mass | 150.14 |
| IUPAC Name | ethane;1,2,3-trimethylbenzene |
| SMILES | CC.Cc1cccc(C)c1C |
| InChI | InChI=1S/C9H12.C2H6/c1-7-5-4-6-8(2)9(7)3;1-2/h4-6H,1-3H3;1-2H3 |
| InChIKey | MEVQRYKSINAABK-UHFFFAOYSA-N |
| XLogP | 3.64 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 150.26 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |