C22H37N — CID 142152742
ethane;N,N,4-trimethylaniline;1,2,3-trimethylbenzene (PubChem CID 142152742) has the molecular formula C22H37N and a molecular weight of 315.55 g/mol. Its IUPAC name is ethane;N,N,4-trimethylaniline;1,2,3-trimethylbenzene.
| Compound Name | ethane;N,N,4-trimethylaniline;1,2,3-trimethylbenzene |
|---|---|
| PubChem CID | 142152742 |
| Molecular Formula | C22H37N |
| Molecular Weight | 315.55 g/mol |
| Exact Mass | 315.29 |
| IUPAC Name | ethane;N,N,4-trimethylaniline;1,2,3-trimethylbenzene |
| SMILES | CC.CC.Cc1ccc(N(C)C)cc1.Cc1cccc(C)c1C |
| InChI | InChI=1S/C9H13N.C9H12.2C2H6/c1-8-4-6-9(7-5-8)10(2)3;1-7-5-4-6-8(2)9(7)3;2*1-2/h4-7H,1-3H3;4-6H,1-3H3;2*1-2H3 |
| InChIKey | JSEMFKCDILKJNK-UHFFFAOYSA-N |
| XLogP | 6.73 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.55 |
| LogP ≤ 5 | 6.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|