C13H21NO2 — CID 161109749
ethenol;N,N,4-trimethylaniline (PubChem CID 161109749) has the molecular formula C13H21NO2 and a molecular weight of 223.32 g/mol. Its IUPAC name is ethenol;N,N,4-trimethylaniline.
| Compound Name | ethenol;N,N,4-trimethylaniline |
|---|---|
| PubChem CID | 161109749 |
| Molecular Formula | C13H21NO2 |
| Molecular Weight | 223.32 g/mol |
| Exact Mass | 223.16 |
| IUPAC Name | ethenol;N,N,4-trimethylaniline |
| SMILES | C=CO.C=CO.Cc1ccc(N(C)C)cc1 |
| InChI | InChI=1S/C9H13N.2C2H4O/c1-8-4-6-9(7-5-8)10(2)3;2*1-2-3/h4-7H,1-3H3;2*2-3H,1H2 |
| InChIKey | UJNNGYNRTZVBGS-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 43.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.32 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'}, {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|