C19H29NO — CID 142497579
ethane;1-methoxy-4-methylbenzene;N,N,4-trimethylaniline (PubChem CID 142497579) has the molecular formula C19H29NO and a molecular weight of 287.45 g/mol. Its IUPAC name is ethane;1-methoxy-4-methylbenzene;N,N,4-trimethylaniline.
| Compound Name | ethane;1-methoxy-4-methylbenzene;N,N,4-trimethylaniline |
|---|---|
| PubChem CID | 142497579 |
| Molecular Formula | C19H29NO |
| Molecular Weight | 287.45 g/mol |
| Exact Mass | 287.22 |
| IUPAC Name | ethane;1-methoxy-4-methylbenzene;N,N,4-trimethylaniline |
| SMILES | CC.COc1ccc(C)cc1.Cc1ccc(N(C)C)cc1 |
| InChI | InChI=1S/C9H13N.C8H10O.C2H6/c1-8-4-6-9(7-5-8)10(2)3;1-7-3-5-8(9-2)6-4-7;1-2/h4-7H,1-3H3;3-6H,1-2H3;1-2H3 |
| InChIKey | YLYJLJUKABKBIM-UHFFFAOYSA-N |
| XLogP | 5.09 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.45 |
| LogP ≤ 5 | 5.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|