C14H25NO — CID 90934747
N,N-diethylethanamine;1-methoxy-4-methylbenzene (PubChem CID 90934747) has the molecular formula C14H25NO and a molecular weight of 223.36 g/mol. Its IUPAC name is N,N-diethylethanamine;1-methoxy-4-methylbenzene.
| Compound Name | N,N-diethylethanamine;1-methoxy-4-methylbenzene |
|---|---|
| PubChem CID | 90934747 |
| Molecular Formula | C14H25NO |
| Molecular Weight | 223.36 g/mol |
| Exact Mass | 223.19 |
| IUPAC Name | N,N-diethylethanamine;1-methoxy-4-methylbenzene |
| SMILES | CCN(CC)CC.COc1ccc(C)cc1 |
| InChI | InChI=1S/C8H10O.C6H15N/c1-7-3-5-8(9-2)6-4-7;1-4-7(5-2)6-3/h3-6H,1-2H3;4-6H2,1-3H3 |
| InChIKey | SMACGNPBXOSYTM-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.36 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |