C20H42Cl2N2 — CID 173431091
bis(N,N-diethylethanamine);1,4-xylene;dihydrochloride (PubChem CID 173431091) has the molecular formula C20H42Cl2N2 and a molecular weight of 381.48 g/mol. Its IUPAC name is bis(N,N-diethylethanamine);1,4-xylene;dihydrochloride.
| Compound Name | bis(N,N-diethylethanamine);1,4-xylene;dihydrochloride |
|---|---|
| PubChem CID | 173431091 |
| Molecular Formula | C20H42Cl2N2 |
| Molecular Weight | 381.48 g/mol |
| Exact Mass | 380.27 |
| IUPAC Name | bis(N,N-diethylethanamine);1,4-xylene;dihydrochloride |
| SMILES | CCN(CC)CC.CCN(CC)CC.Cc1ccc(C)cc1.Cl.Cl |
| InChI | InChI=1S/C8H10.2C6H15N.2ClH/c1-7-3-5-8(2)6-4-7;2*1-4-7(5-2)6-3;;/h3-6H,1-2H3;2*4-6H2,1-3H3;2*1H |
| InChIKey | TUWVADPBRNIZQN-UHFFFAOYSA-N |
| XLogP | 5.84 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.48 |
| LogP ≤ 5 | 5.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |