C16H29NO2S — CID 90732645
N,N-diethylethanamine;1-methyl-4-propylsulfonylbenzene (PubChem CID 90732645) has the molecular formula C16H29NO2S and a molecular weight of 299.48 g/mol. Its IUPAC name is N,N-diethylethanamine;1-methyl-4-propylsulfonylbenzene.
| Compound Name | N,N-diethylethanamine;1-methyl-4-propylsulfonylbenzene |
|---|---|
| PubChem CID | 90732645 |
| Molecular Formula | C16H29NO2S |
| Molecular Weight | 299.48 g/mol |
| Exact Mass | 299.19 |
| IUPAC Name | N,N-diethylethanamine;1-methyl-4-propylsulfonylbenzene |
| SMILES | CCCS(=O)(=O)c1ccc(C)cc1.CCN(CC)CC |
| InChI | InChI=1S/C10H14O2S.C6H15N/c1-3-8-13(11,12)10-6-4-9(2)5-7-10;1-4-7(5-2)6-3/h4-7H,3,8H2,1-2H3;4-6H2,1-3H3 |
| InChIKey | COYQVAAHWWGJKJ-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.48 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |