C22H31NO4S2 — CID 3747253
N,N-bis[(4-methylphenyl)sulfonylmethyl]hexan-1-amine (PubChem CID 3747253) has the molecular formula C22H31NO4S2 and a molecular weight of 437.63 g/mol. Its IUPAC name is N,N-bis[(4-methylphenyl)sulfonylmethyl]hexan-1-amine.
| Compound Name | N,N-bis[(4-methylphenyl)sulfonylmethyl]hexan-1-amine |
|---|---|
| PubChem CID | 3747253 |
| Molecular Formula | C22H31NO4S2 |
| Molecular Weight | 437.63 g/mol |
| Exact Mass | 437.17 |
| IUPAC Name | N,N-bis[(4-methylphenyl)sulfonylmethyl]hexan-1-amine |
| SMILES | CCCCCCN(CS(=O)(=O)c1ccc(C)cc1)CS(=O)(=O)c1ccc(C)cc1 |
| InChI | InChI=1S/C22H31NO4S2/c1-4-5-6-7-16-23(17-28(24,25)21-12-8-19(2)9-13-21)18-29(26,27)22-14-10-20(3)11-15-22/h8-15H,4-7,16-18H2,1-3H3 |
| InChIKey | JNUXLFWPSMEIDT-UHFFFAOYSA-N |
| XLogP | 4.35 |
| TPSA | 71.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.63 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|