C30H55NO5S — CID 88515557
2-[2-hydroxyethyl-[(Z)-nonadec-10-enyl]amino]ethanol;4-methylbenzenesulfonic acid (PubChem CID 88515557) has the molecular formula C30H55NO5S and a molecular weight of 541.84 g/mol. Its IUPAC name is 2-[2-hydroxyethyl-[(Z)-nonadec-10-enyl]amino]ethanol;4-methylbenzenesulfonic acid.
| Compound Name | 2-[2-hydroxyethyl-[(Z)-nonadec-10-enyl]amino]ethanol;4-methylbenzenesulfonic acid |
|---|---|
| PubChem CID | 88515557 |
| Molecular Formula | C30H55NO5S |
| Molecular Weight | 541.84 g/mol |
| Exact Mass | 541.38 |
| IUPAC Name | 2-[2-hydroxyethyl-[(Z)-nonadec-10-enyl]amino]ethanol;4-methylbenzenesulfonic acid |
| SMILES | CCCCCCCC/C=C\CCCCCCCCCN(CCO)CCO.Cc1ccc(S(=O)(=O)O)cc1 |
| InChI | InChI=1S/C23H47NO2.C7H8O3S/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-24(20-22-25)21-23-26;1-6-2-4-7(5-3-6)11(8,9)10/h9-10,25-26H,2-8,11-23H2,1H3;2-5H,1H3,(H,8,9,10)/b10-9-; |
| InChIKey | DEYJEDWPSLWCMM-KVVVOXFISA-N |
| XLogP | 6.94 |
| TPSA | 98.07 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 22 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 541.84 |
| LogP ≤ 5 | 6.94 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|