C24H51NO9S — CID 173461101
2-[bis(2-hydroxyethyl)amino]ethanol;octadec-9-enoic acid;sulfuric acid (PubChem CID 173461101) has the molecular formula C24H51NO9S and a molecular weight of 529.74 g/mol. Its IUPAC name is 2-[bis(2-hydroxyethyl)amino]ethanol;octadec-9-enoic acid;sulfuric acid.
| Compound Name | 2-[bis(2-hydroxyethyl)amino]ethanol;octadec-9-enoic acid;sulfuric acid |
|---|---|
| PubChem CID | 173461101 |
| Molecular Formula | C24H51NO9S |
| Molecular Weight | 529.74 g/mol |
| Exact Mass | 529.33 |
| IUPAC Name | 2-[bis(2-hydroxyethyl)amino]ethanol;octadec-9-enoic acid;sulfuric acid |
| SMILES | CCCCCCCCC=CCCCCCCCC(=O)O.O=S(=O)(O)O.OCCN(CCO)CCO |
| InChI | InChI=1S/C18H34O2.C6H15NO3.H2O4S/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18(19)20;8-4-1-7(2-5-9)3-6-10;1-5(2,3)4/h9-10H,2-8,11-17H2,1H3,(H,19,20);8-10H,1-6H2;(H2,1,2,3,4) |
| InChIKey | ZDXWFNDNANZDAW-UHFFFAOYSA-N |
| XLogP | 3.72 |
| TPSA | 175.83 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 529.74 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|