C42H79NO7 — CID 6455046
2-[bis(2-hydroxyethyl)amino]ethanol;bis((9Z,12Z)-octadeca-9,12-dienoic acid) (PubChem CID 6455046) has the molecular formula C42H79NO7 and a molecular weight of 710.09 g/mol. Its IUPAC name is 2-[bis(2-hydroxyethyl)amino]ethanol;bis((9Z,12Z)-octadeca-9,12-dienoic acid).
| Compound Name | 2-[bis(2-hydroxyethyl)amino]ethanol;bis((9Z,12Z)-octadeca-9,12-dienoic acid) |
|---|---|
| PubChem CID | 6455046 |
| Molecular Formula | C42H79NO7 |
| Molecular Weight | 710.09 g/mol |
| Exact Mass | 709.59 |
| IUPAC Name | 2-[bis(2-hydroxyethyl)amino]ethanol;bis((9Z,12Z)-octadeca-9,12-dienoic acid) |
| SMILES | CCCCC/C=C\C/C=C\CCCCCCCC(=O)O.CCCCC/C=C\C/C=C\CCCCCCCC(=O)O.OCCN(CCO)CCO |
| InChI | InChI=1S/2C18H32O2.C6H15NO3/c2*1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18(19)20;8-4-1-7(2-5-9)3-6-10/h2*6-7,9-10H,2-5,8,11-17H2,1H3,(H,19,20);8-10H,1-6H2/b2*7-6-,10-9-; |
| InChIKey | MCVBXQZQMJIUNU-GRVYQHKQSA-N |
| XLogP | 10.03 |
| TPSA | 138.53 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 34 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 710.09 |
| LogP ≤ 5 | 10.03 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|