C27H55NO2 — CID 173188993
N,N-dipropylpropan-1-amine;(Z)-octadec-9-enoic acid (PubChem CID 173188993) has the molecular formula C27H55NO2 and a molecular weight of 425.74 g/mol. Its IUPAC name is N,N-dipropylpropan-1-amine;(Z)-octadec-9-enoic acid.
| Compound Name | N,N-dipropylpropan-1-amine;(Z)-octadec-9-enoic acid |
|---|---|
| PubChem CID | 173188993 |
| Molecular Formula | C27H55NO2 |
| Molecular Weight | 425.74 g/mol |
| Exact Mass | 425.42 |
| IUPAC Name | N,N-dipropylpropan-1-amine;(Z)-octadec-9-enoic acid |
| SMILES | CCCCCCCC/C=C\CCCCCCCC(=O)O.CCCN(CCC)CCC |
| InChI | InChI=1S/C18H34O2.C9H21N/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18(19)20;1-4-7-10(8-5-2)9-6-3/h9-10H,2-8,11-17H2,1H3,(H,19,20);4-9H2,1-3H3/b10-9-; |
| InChIKey | ZMYFQMOLRHHKDX-KVVVOXFISA-N |
| XLogP | 8.63 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.74 |
| LogP ≤ 5 | 8.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|