About docosanoic acid;(Z)-docos-13-en-1-ol
docosanoic acid;(Z)-docos-13-en-1-ol (PubChem CID 174511877) has the molecular formula C44H88O3
and a molecular weight of 665.19 g/mol. Its IUPAC name is docosanoic acid;(Z)-docos-13-en-1-ol.
Molecular Properties
| Compound Name | docosanoic acid;(Z)-docos-13-en-1-ol |
| PubChem CID | 174511877 |
| Molecular Formula | C44H88O3 |
| Molecular Weight | 665.19 g/mol |
| Exact Mass | 664.67 |
| IUPAC Name | docosanoic acid;(Z)-docos-13-en-1-ol |
| SMILES | CCCCCCCC/C=C\CCCCCCCCCCCCO.CCCCCCCCCCCCCCCCCCCCCC(=O)O |
| InChI | InChI=1S/C22H44O2.C22H44O/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-20-21-22(23)24;1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-20-21-22-23/h2-21H2,1H3,(H,23,24);9-10,23H,2-8,11-22H2,1H3/b;10-9- |
| InChIKey | ZAZBXSWERRVKQT-SVMKZPJVSA-N |
| XLogP | 15.47 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 39 |
| Heavy Atoms | 47 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 665.19 |
| LogP ≤ 5 | 15.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze docosanoic acid;(Z)-docos-13-en-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of docosanoic acid;(Z)-docos-13-en-1-ol?
The IUPAC name of docosanoic acid;(Z)-docos-13-en-1-ol (CID 174511877) is docosanoic acid;(Z)-docos-13-en-1-ol.
What is the SMILES notation for docosanoic acid;(Z)-docos-13-en-1-ol?
The canonical SMILES for docosanoic acid;(Z)-docos-13-en-1-ol is CCCCCCCC/C=C\CCCCCCCCCCCCO.CCCCCCCCCCCCCCCCCCCCCC(=O)O.
What is the InChIKey of docosanoic acid;(Z)-docos-13-en-1-ol?
The InChIKey is ZAZBXSWERRVKQT-SVMKZPJVSA-N. The full InChI is InChI=1S/C22H44O2.C22H44O/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-20-21-22(23)24;1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-20-21-22-23/h2-21H2,1H3,(H,23,24);9-10,23H,2-8,11-22H2,1H3/b;10-9-.
What are the key properties of docosanoic acid;(Z)-docos-13-en-1-ol?
docosanoic acid;(Z)-docos-13-en-1-ol has a molecular weight of 665.19 g/mol, XLogP of 15.47, 39 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for docosanoic acid;(Z)-docos-13-en-1-ol is sourced from PubChem (CID 174511877), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).