C22H44O4 — CID 57346584
butane-1,4-diol;octadec-9-enoic acid (PubChem CID 57346584) has the molecular formula C22H44O4 and a molecular weight of 372.59 g/mol. Its IUPAC name is butane-1,4-diol;octadec-9-enoic acid.
| Compound Name | butane-1,4-diol;octadec-9-enoic acid |
|---|---|
| PubChem CID | 57346584 |
| Molecular Formula | C22H44O4 |
| Molecular Weight | 372.59 g/mol |
| Exact Mass | 372.32 |
| IUPAC Name | butane-1,4-diol;octadec-9-enoic acid |
| SMILES | CCCCCCCCC=CCCCCCCCC(=O)O.OCCCCO |
| InChI | InChI=1S/C18H34O2.C4H10O2/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18(19)20;5-3-1-2-4-6/h9-10H,2-8,11-17H2,1H3,(H,19,20);5-6H,1-4H2 |
| InChIKey | QVDUKTRWNQLRCO-UHFFFAOYSA-N |
| XLogP | 5.86 |
| TPSA | 77.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.59 |
| LogP ≤ 5 | 5.86 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|