C28H55NO — CID 155275750
2-[[(9Z,12Z)-octadeca-9,12-dienyl]-octylamino]ethanol (PubChem CID 155275750) has the molecular formula C28H55NO and a molecular weight of 421.75 g/mol. Its IUPAC name is 2-[[(9Z,12Z)-octadeca-9,12-dienyl]-octylamino]ethanol.
| Compound Name | 2-[[(9Z,12Z)-octadeca-9,12-dienyl]-octylamino]ethanol |
|---|---|
| PubChem CID | 155275750 |
| Molecular Formula | C28H55NO |
| Molecular Weight | 421.75 g/mol |
| Exact Mass | 421.43 |
| IUPAC Name | 2-[[(9Z,12Z)-octadeca-9,12-dienyl]-octylamino]ethanol |
| SMILES | CCCCC/C=C\C/C=C\CCCCCCCCN(CCO)CCCCCCCC |
| InChI | InChI=1S/C28H55NO/c1-3-5-7-9-11-12-13-14-15-16-17-18-19-20-22-24-26-29(27-28-30)25-23-21-10-8-6-4-2/h11-12,14-15,30H,3-10,13,16-28H2,1-2H3/b12-11-,15-14- |
| InChIKey | BDDLSTKSJORJSU-HDXUUTQWSA-N |
| XLogP | 8.45 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 24 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.75 |
| LogP ≤ 5 | 8.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|