C41H78N2O — CID 164814017
2-[2-[bis[(9Z,12Z)-octadeca-9,12-dienyl]amino]ethyl-methylamino]ethanol (PubChem CID 164814017) has the molecular formula C41H78N2O and a molecular weight of 615.09 g/mol. Its IUPAC name is 2-[2-[bis[(9Z,12Z)-octadeca-9,12-dienyl]amino]ethyl-methylamino]ethanol.
| Compound Name | 2-[2-[bis[(9Z,12Z)-octadeca-9,12-dienyl]amino]ethyl-methylamino]ethanol |
|---|---|
| PubChem CID | 164814017 |
| Molecular Formula | C41H78N2O |
| Molecular Weight | 615.09 g/mol |
| Exact Mass | 614.61 |
| IUPAC Name | 2-[2-[bis[(9Z,12Z)-octadeca-9,12-dienyl]amino]ethyl-methylamino]ethanol |
| SMILES | CCCCC/C=C\C/C=C\CCCCCCCCN(CCCCCCCC/C=C\C/C=C\CCCCC)CCN(C)CCO |
| InChI | InChI=1S/C41H78N2O/c1-4-6-8-10-12-14-16-18-20-22-24-26-28-30-32-34-36-43(39-38-42(3)40-41-44)37-35-33-31-29-27-25-23-21-19-17-15-13-11-9-7-5-2/h12-15,18-21,44H,4-11,16-17,22-41H2,1-3H3/b14-12-,15-13-,20-18-,21-19- |
| InChIKey | WPZBUUAKLRSTEO-QYCRHRGJSA-N |
| XLogP | 11.84 |
| TPSA | 26.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 35 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 615.09 |
| LogP ≤ 5 | 11.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|