C57H108N2 — CID 176570747
methane;N-methyl-N,N',N'-tris[(9Z,12Z)-octadeca-9,12-dienyl]methanediamine (PubChem CID 176570747) has the molecular formula C57H108N2 and a molecular weight of 821.50 g/mol. Its IUPAC name is methane;N-methyl-N,N',N'-tris[(9Z,12Z)-octadeca-9,12-dienyl]methanediamine.
| Compound Name | methane;N-methyl-N,N',N'-tris[(9Z,12Z)-octadeca-9,12-dienyl]methanediamine |
|---|---|
| PubChem CID | 176570747 |
| Molecular Formula | C57H108N2 |
| Molecular Weight | 821.50 g/mol |
| Exact Mass | 820.85 |
| IUPAC Name | methane;N-methyl-N,N',N'-tris[(9Z,12Z)-octadeca-9,12-dienyl]methanediamine |
| SMILES | C.CCCCC/C=C\C/C=C\CCCCCCCCN(C)CN(CCCCCCCC/C=C\C/C=C\CCCCC)CCCCCCCC/C=C\C/C=C\CCCCC |
| InChI | InChI=1S/C56H104N2.CH4/c1-5-8-11-14-17-20-23-26-29-32-35-38-41-44-47-50-53-57(4)56-58(54-51-48-45-42-39-36-33-30-27-24-21-18-15-12-9-6-2)55-52-49-46-43-40-37-34-31-28-25-22-19-16-13-10-7-3;/h17-22,26-31H,5-16,23-25,32-56H2,1-4H3;1H4/b20-17-,21-18-,22-19-,29-26-,30-27-,31-28-; |
| InChIKey | YNTCOIHLIVALPT-ZTYURRSESA-N |
| XLogP | 19.25 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 47 |
| Heavy Atoms | 59 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 821.50 |
| LogP ≤ 5 | 19.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|