C76H140N2S2 — CID 164813958
(9Z,12Z)-N-[2-[2-[bis[(9Z,12Z)-octadeca-9,12-dienyl]amino]ethyldisulfanyl]ethyl]-N-[(9Z,12Z)-octadeca-9,12-dienyl]octadeca-9,12-dien-1-amine (PubChem CID 164813958) has the molecular formula C76H140N2S2 and a molecular weight of 1146.10 g/mol. Its IUPAC name is (9Z,12Z)-N-[2-[2-[bis[(9Z,12Z)-octadeca-9,12-dienyl]amino]ethyldisulfanyl]ethyl]-N-[(9Z,12Z)-octadeca-9,12-dienyl]octadeca-9,12-dien-1-amine.
| Compound Name | (9Z,12Z)-N-[2-[2-[bis[(9Z,12Z)-octadeca-9,12-dienyl]amino]ethyldisulfanyl]ethyl]-N-[(9Z,12Z)-octadeca-9,12-dienyl]octadeca-9,12-dien-1-amine |
|---|---|
| PubChem CID | 164813958 |
| Molecular Formula | C76H140N2S2 |
| Molecular Weight | 1146.10 g/mol |
| Exact Mass | 1145.05 |
| IUPAC Name | (9Z,12Z)-N-[2-[2-[bis[(9Z,12Z)-octadeca-9,12-dienyl]amino]ethyldisulfanyl]ethyl]-N-[(9Z,12Z)-octadeca-9,12-dienyl]octadeca-9,12-dien-1-amine |
| SMILES | CCCCC/C=C\C/C=C\CCCCCCCCN(CCCCCCCC/C=C\C/C=C\CCCCC)CCSSCCN(CCCCCCCC/C=C\C/C=C\CCCCC)CCCCCCCC/C=C\C/C=C\CCCCC |
| InChI | InChI=1S/C76H140N2S2/c1-5-9-13-17-21-25-29-33-37-41-45-49-53-57-61-65-69-77(70-66-62-58-54-50-46-42-38-34-30-26-22-18-14-10-6-2)73-75-79-80-76-74-78(71-67-63-59-55-51-47-43-39-35-31-27-23-19-15-11-7-3)72-68-64-60-56-52-48-44-40-36-32-28-24-20-16-12-8-4/h21-28,33-40H,5-20,29-32,41-76H2,1-4H3/b25-21-,26-22-,27-23-,28-24-,37-33-,38-34-,39-35-,40-36- |
| InChIKey | UWCHJVVBAPKOQF-RGLFHLPNSA-N |
| XLogP | 26.23 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 67 |
| Heavy Atoms | 80 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1146.10 |
| LogP ≤ 5 | 26.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|