C38H71N — CID 89212218
(9Z,12Z)-N-[(9Z,12Z)-heptadeca-9,12-dienyl]-N-propyloctadeca-9,12-dien-1-amine (PubChem CID 89212218) has the molecular formula C38H71N and a molecular weight of 541.99 g/mol. Its IUPAC name is (9Z,12Z)-N-[(9Z,12Z)-heptadeca-9,12-dienyl]-N-propyloctadeca-9,12-dien-1-amine.
| Compound Name | (9Z,12Z)-N-[(9Z,12Z)-heptadeca-9,12-dienyl]-N-propyloctadeca-9,12-dien-1-amine |
|---|---|
| PubChem CID | 89212218 |
| Molecular Formula | C38H71N |
| Molecular Weight | 541.99 g/mol |
| Exact Mass | 541.56 |
| IUPAC Name | (9Z,12Z)-N-[(9Z,12Z)-heptadeca-9,12-dienyl]-N-propyloctadeca-9,12-dien-1-amine |
| SMILES | CCCC/C=C\C/C=C\CCCCCCCCN(CCC)CCCCCCCC/C=C\C/C=C\CCCCC |
| InChI | InChI=1S/C38H71N/c1-4-7-9-11-13-15-17-19-21-23-25-27-29-31-33-35-38-39(36-6-3)37-34-32-30-28-26-24-22-20-18-16-14-12-10-8-5-2/h12-15,18-21H,4-11,16-17,22-38H2,1-3H3/b14-12-,15-13-,20-18-,21-19- |
| InChIKey | WQMMNERMIQUZDP-QYCRHRGJSA-N |
| XLogP | 12.94 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 31 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 541.99 |
| LogP ≤ 5 | 12.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|