C24H50N2 — CID 6437658
N,N,N'-trimethyl-N'-[(Z)-octadec-9-enyl]propane-1,3-diamine (PubChem CID 6437658) has the molecular formula C24H50N2 and a molecular weight of 366.68 g/mol. Its IUPAC name is N,N,N'-trimethyl-N'-[(Z)-octadec-9-enyl]propane-1,3-diamine.
| Compound Name | N,N,N'-trimethyl-N'-[(Z)-octadec-9-enyl]propane-1,3-diamine |
|---|---|
| PubChem CID | 6437658 |
| Molecular Formula | C24H50N2 |
| Molecular Weight | 366.68 g/mol |
| Exact Mass | 366.40 |
| IUPAC Name | N,N,N'-trimethyl-N'-[(Z)-octadec-9-enyl]propane-1,3-diamine |
| SMILES | CCCCCCCC/C=C\CCCCCCCCN(C)CCCN(C)C |
| InChI | InChI=1S/C24H50N2/c1-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-20-23-26(4)24-21-22-25(2)3/h12-13H,5-11,14-24H2,1-4H3/b13-12- |
| InChIKey | BTLOXYBWVZTCMD-SEYXRHQNSA-N |
| XLogP | 6.91 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.68 |
| LogP ≤ 5 | 6.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|