C20H46N2 — CID 161279104
N,N-dimethyloctan-1-amine (PubChem CID 161279104) has the molecular formula C20H46N2 and a molecular weight of 314.60 g/mol. Its IUPAC name is N,N-dimethyloctan-1-amine.
| Compound Name | N,N-dimethyloctan-1-amine |
|---|---|
| PubChem CID | 161279104 |
| Molecular Formula | C20H46N2 |
| Molecular Weight | 314.60 g/mol |
| Exact Mass | 314.37 |
| IUPAC Name | N,N-dimethyloctan-1-amine |
| SMILES | CCCCCCCCN(C)C.CCCCCCCCN(C)C |
| InChI | InChI=1S/2C10H23N/c2*1-4-5-6-7-8-9-10-11(2)3/h2*4-10H2,1-3H3 |
| InChIKey | VEVLRSAIDXLSEU-UHFFFAOYSA-N |
| XLogP | 5.82 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.60 |
| LogP ≤ 5 | 5.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|