About N,N-dimethyltetracosan-1-amine;hydrochloride
N,N-dimethyltetracosan-1-amine;hydrochloride (PubChem CID 173002341) has the molecular formula C26H56ClN
and a molecular weight of 418.19 g/mol. Its IUPAC name is N,N-dimethyltetracosan-1-amine;hydrochloride.
Molecular Properties
| Compound Name | N,N-dimethyltetracosan-1-amine;hydrochloride |
| PubChem CID | 173002341 |
| Molecular Formula | C26H56ClN |
| Molecular Weight | 418.19 g/mol |
| Exact Mass | 417.41 |
| IUPAC Name | N,N-dimethyltetracosan-1-amine;hydrochloride |
| SMILES | CCCCCCCCCCCCCCCCCCCCCCCCN(C)C.Cl |
| InChI | InChI=1S/C26H55N.ClH/c1-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-20-21-22-23-24-25-26-27(2)3;/h4-26H2,1-3H3;1H |
| InChIKey | SPAXCNZOJWHFCB-UHFFFAOYSA-N |
| XLogP | 9.57 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 23 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 418.19 |
| LogP ≤ 5 | 9.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze N,N-dimethyltetracosan-1-amine;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N,N-dimethyltetracosan-1-amine;hydrochloride?
The IUPAC name of N,N-dimethyltetracosan-1-amine;hydrochloride (CID 173002341) is N,N-dimethyltetracosan-1-amine;hydrochloride.
What is the SMILES notation for N,N-dimethyltetracosan-1-amine;hydrochloride?
The canonical SMILES for N,N-dimethyltetracosan-1-amine;hydrochloride is CCCCCCCCCCCCCCCCCCCCCCCCN(C)C.Cl.
What is the InChIKey of N,N-dimethyltetracosan-1-amine;hydrochloride?
The InChIKey is SPAXCNZOJWHFCB-UHFFFAOYSA-N. The full InChI is InChI=1S/C26H55N.ClH/c1-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-20-21-22-23-24-25-26-27(2)3;/h4-26H2,1-3H3;1H.
What are the key properties of N,N-dimethyltetracosan-1-amine;hydrochloride?
N,N-dimethyltetracosan-1-amine;hydrochloride has a molecular weight of 418.19 g/mol, XLogP of 9.57, 23 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for N,N-dimethyltetracosan-1-amine;hydrochloride is sourced from PubChem (CID 173002341), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).