C20H44ClN — CID 87849002
chloroethane;N,N-dimethylhexadecan-1-amine (PubChem CID 87849002) has the molecular formula C20H44ClN and a molecular weight of 334.03 g/mol. Its IUPAC name is chloroethane;N,N-dimethylhexadecan-1-amine.
| Compound Name | chloroethane;N,N-dimethylhexadecan-1-amine |
|---|---|
| PubChem CID | 87849002 |
| Molecular Formula | C20H44ClN |
| Molecular Weight | 334.03 g/mol |
| Exact Mass | 333.32 |
| IUPAC Name | chloroethane;N,N-dimethylhexadecan-1-amine |
| SMILES | CCCCCCCCCCCCCCCCN(C)C.CCCl |
| InChI | InChI=1S/C18H39N.C2H5Cl/c1-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19(2)3;1-2-3/h4-18H2,1-3H3;2H2,1H3 |
| InChIKey | TYMAZJNKOFSTLC-UHFFFAOYSA-N |
| XLogP | 7.27 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.03 |
| LogP ≤ 5 | 7.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|