About N,N-dimethyldecan-1-amine;ruthenium
N,N-dimethyldecan-1-amine;ruthenium (PubChem CID 158300226) has the molecular formula C12H27NRu
and a molecular weight of 286.42 g/mol. Its IUPAC name is N,N-dimethyldecan-1-amine;ruthenium.
Molecular Properties
| Compound Name | N,N-dimethyldecan-1-amine;ruthenium |
| PubChem CID | 158300226 |
| Molecular Formula | C12H27NRu |
| Molecular Weight | 286.42 g/mol |
| Exact Mass | 287.12 |
| IUPAC Name | N,N-dimethyldecan-1-amine;ruthenium |
| SMILES | CCCCCCCCCCN(C)C.[Ru] |
| InChI | InChI=1S/C12H27N.Ru/c1-4-5-6-7-8-9-10-11-12-13(2)3;/h4-12H2,1-3H3; |
| InChIKey | GMKIIXQDSZSLPP-UHFFFAOYSA-N |
| XLogP | 3.69 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 286.42 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze N,N-dimethyldecan-1-amine;ruthenium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N,N-dimethyldecan-1-amine;ruthenium?
The IUPAC name of N,N-dimethyldecan-1-amine;ruthenium (CID 158300226) is N,N-dimethyldecan-1-amine;ruthenium.
What is the SMILES notation for N,N-dimethyldecan-1-amine;ruthenium?
The canonical SMILES for N,N-dimethyldecan-1-amine;ruthenium is CCCCCCCCCCN(C)C.[Ru].
What is the InChIKey of N,N-dimethyldecan-1-amine;ruthenium?
The InChIKey is GMKIIXQDSZSLPP-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H27N.Ru/c1-4-5-6-7-8-9-10-11-12-13(2)3;/h4-12H2,1-3H3;.
What are the key properties of N,N-dimethyldecan-1-amine;ruthenium?
N,N-dimethyldecan-1-amine;ruthenium has a molecular weight of 286.42 g/mol, XLogP of 3.69, 9 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for N,N-dimethyldecan-1-amine;ruthenium is sourced from PubChem (CID 158300226), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).