About borane;N,N-dimethylhexan-1-amine
borane;N,N-dimethylhexan-1-amine (PubChem CID 134905026) has the molecular formula C8H22BN
and a molecular weight of 143.08 g/mol. Its IUPAC name is borane;N,N-dimethylhexan-1-amine.
Molecular Properties
| Compound Name | borane;N,N-dimethylhexan-1-amine |
| PubChem CID | 134905026 |
| Molecular Formula | C8H22BN |
| Molecular Weight | 143.08 g/mol |
| Exact Mass | 143.18 |
| IUPAC Name | borane;N,N-dimethylhexan-1-amine |
| SMILES | B.CCCCCCN(C)C |
| InChI | InChI=1S/C8H19N.BH3/c1-4-5-6-7-8-9(2)3;/h4-8H2,1-3H3;1H3 |
| InChIKey | IJQKOGMGXOEFFI-UHFFFAOYSA-N |
| XLogP | 0.94 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 143.08 |
| LogP ≤ 5 | 0.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze borane;N,N-dimethylhexan-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of borane;N,N-dimethylhexan-1-amine?
The IUPAC name of borane;N,N-dimethylhexan-1-amine (CID 134905026) is borane;N,N-dimethylhexan-1-amine.
What is the SMILES notation for borane;N,N-dimethylhexan-1-amine?
The canonical SMILES for borane;N,N-dimethylhexan-1-amine is B.CCCCCCN(C)C.
What is the InChIKey of borane;N,N-dimethylhexan-1-amine?
The InChIKey is IJQKOGMGXOEFFI-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H19N.BH3/c1-4-5-6-7-8-9(2)3;/h4-8H2,1-3H3;1H3.
What are the key properties of borane;N,N-dimethylhexan-1-amine?
borane;N,N-dimethylhexan-1-amine has a molecular weight of 143.08 g/mol, XLogP of 0.94, 5 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for borane;N,N-dimethylhexan-1-amine is sourced from PubChem (CID 134905026), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).